C17H20N2 — CID 143904575
N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine (PubChem CID 143904575) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine.
| Compound Name | N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine |
|---|---|
| PubChem CID | 143904575 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[[(1E,6Z)-cycloocta-1,4,6-trien-1-yl]methyl]-1-ethenyl-6-methylpyridin-2-imine |
| SMILES | C=Cn1c(C)ccc/c1=N\C/C1=C/CC=C/C=C\C1 |
| InChI | InChI=1S/C17H20N2/c1-3-19-15(2)10-9-13-17(19)18-14-16-11-7-5-4-6-8-12-16/h3-7,9-10,12-13H,1,8,11,14H2,2H3/b6-4?,7-5-,16-12+,18-17+ |
| InChIKey | ONOXYJAPMHVAEV-KTIMRXNLSA-N |
| XLogP | 3.63 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|