C7H11IN2 — CID 90654291
1,4-dimethylpyridin-2-imine;hydroiodide (PubChem CID 90654291) has the molecular formula C7H11IN2 and a molecular weight of 250.08 g/mol. Its IUPAC name is 1,4-dimethylpyridin-2-imine;hydroiodide.
| Compound Name | 1,4-dimethylpyridin-2-imine;hydroiodide |
|---|---|
| PubChem CID | 90654291 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1,4-dimethylpyridin-2-imine;hydroiodide |
| SMILES | I.[H]/N=c1\cc(C)ccn1C |
| InChI | InChI=1S/C7H10N2.HI/c1-6-3-4-9(2)7(8)5-6;/h3-5,8H,1-2H3;1H/b8-7+; |
| InChIKey | FYZOLDNEGRSROJ-USRGLUTNSA-N |
| XLogP | 1.43 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|