C17H23N5 — CID 123801275
N'-(3,4-dihydropyridin-6-ylmethylideneamino)-6-ethyl-N-imino-2-methylideneocta-3,6-dienimidamide (PubChem CID 123801275) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is N'-(3,4-dihydropyridin-6-ylmethylideneamino)-6-ethyl-N-imino-2-methylideneocta-3,6-dienimidamide.
| Compound Name | N'-(3,4-dihydropyridin-6-ylmethylideneamino)-6-ethyl-N-imino-2-methylideneocta-3,6-dienimidamide |
|---|---|
| PubChem CID | 123801275 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N'-(3,4-dihydropyridin-6-ylmethylideneamino)-6-ethyl-N-imino-2-methylideneocta-3,6-dienimidamide |
| SMILES | [H]/N=N/C(=NN=CC1=CCCC=N1)C(=C)C=CCC(=CC)CC |
| InChI | InChI=1S/C17H23N5/c1-4-15(5-2)10-8-9-14(3)17(21-18)22-20-13-16-11-6-7-12-19-16/h4,8-9,11-13,18H,3,5-7,10H2,1-2H3/b9-8?,15-4?,20-13?,21-18+,22-17? |
| InChIKey | VMYCMGZFAVWONJ-MJYAWREOSA-N |
| XLogP | 5.01 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|