C14H20N4 — CID 130256138
(E,4Z)-N'-[(3E)-hexa-1,3-dien-3-yl]-2-methyl-4-[(E)-prop-2-enylidenehydrazinylidene]but-2-enimidamide (PubChem CID 130256138) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is (E,4Z)-N'-[(3E)-hexa-1,3-dien-3-yl]-2-methyl-4-[(E)-prop-2-enylidenehydrazinylidene]but-2-enimidamide.
| Compound Name | (E,4Z)-N'-[(3E)-hexa-1,3-dien-3-yl]-2-methyl-4-[(E)-prop-2-enylidenehydrazinylidene]but-2-enimidamide |
|---|---|
| PubChem CID | 130256138 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (E,4Z)-N'-[(3E)-hexa-1,3-dien-3-yl]-2-methyl-4-[(E)-prop-2-enylidenehydrazinylidene]but-2-enimidamide |
| SMILES | C=C/C=N/N=C\C=C(C)\C(N)=N\C(C=C)=C\CC |
| InChI | InChI=1S/C14H20N4/c1-5-8-13(7-3)18-14(15)12(4)9-11-17-16-10-6-2/h6-11H,2-3,5H2,1,4H3,(H2,15,18)/b12-9+,13-8+,16-10+,17-11- |
| InChIKey | NIQXQRDTGRCHBM-XBQOXGRZSA-N |
| XLogP | 3.01 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|