About 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium
3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium (PubChem CID 90857939) has the molecular formula C9H9N2+
and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium.
Analyze 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium?
The IUPAC name of 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium (CID 90857939) is 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium.
What is the SMILES notation for 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium?
The canonical SMILES for 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium is C=C1N=c2[nH+]cccc2=C1C.
What is the InChIKey of 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium?
The InChIKey is PDXKMXFSHXLJOA-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H8N2/c1-6-7(2)11-9-8(6)4-3-5-10-9/h3-5H,2H2,1H3/p+1.
What are the key properties of 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium?
3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium has a molecular weight of 145.18 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-methylidenepyrrolo[2,3-b]pyridin-7-ium is sourced from PubChem (CID 90857939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).