C16H28N4 — CID 123983054
(2Z,4E)-N'-ethyl-4-methyl-2-(methylideneamino)-3-(pentylideneamino)hepta-2,4-dienimidamide (PubChem CID 123983054) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is (2Z,4E)-N'-ethyl-4-methyl-2-(methylideneamino)-3-(pentylideneamino)hepta-2,4-dienimidamide.
| Compound Name | (2Z,4E)-N'-ethyl-4-methyl-2-(methylideneamino)-3-(pentylideneamino)hepta-2,4-dienimidamide |
|---|---|
| PubChem CID | 123983054 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | (2Z,4E)-N'-ethyl-4-methyl-2-(methylideneamino)-3-(pentylideneamino)hepta-2,4-dienimidamide |
| SMILES | C=NC(/C(N)=N/CC)=C(\N=C\CCCC)C(/C)=C/CC |
| InChI | InChI=1S/C16H28N4/c1-6-9-10-12-20-14(13(4)11-7-2)15(18-5)16(17)19-8-3/h11-12H,5-10H2,1-4H3,(H2,17,19)/b13-11+,15-14-,20-12+ |
| InChIKey | XDJPZWUHJMEVJR-BWACJNFKSA-N |
| XLogP | 3.89 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|