C8H12N4 — CID 162731207
7-methanimidoyl-4-methyl-3H-azepine-2,6-diamine (PubChem CID 162731207) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 7-methanimidoyl-4-methyl-3H-azepine-2,6-diamine.
| Compound Name | 7-methanimidoyl-4-methyl-3H-azepine-2,6-diamine |
|---|---|
| PubChem CID | 162731207 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 7-methanimidoyl-4-methyl-3H-azepine-2,6-diamine |
| SMILES | [H]/N=C/C1=C(N)C=C(C)CC(N)=N1 |
| InChI | InChI=1S/C8H12N4/c1-5-2-6(10)7(4-9)12-8(11)3-5/h2,4,9H,3,10H2,1H3,(H2,11,12)/b9-4+ |
| InChIKey | UGCFBGWIHLKHKR-RUDMXATFSA-N |
| XLogP | 0.51 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|