C8H8N4 — CID 91539100
2H-pyrido[2,3-e][1,4]diazepin-2-amine (PubChem CID 91539100) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 2H-pyrido[2,3-e][1,4]diazepin-2-amine.
| Compound Name | 2H-pyrido[2,3-e][1,4]diazepin-2-amine |
|---|---|
| PubChem CID | 91539100 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2H-pyrido[2,3-e][1,4]diazepin-2-amine |
| SMILES | NC1C=NC=c2cccnc2=N1 |
| InChI | InChI=1S/C8H8N4/c9-7-5-10-4-6-2-1-3-11-8(6)12-7/h1-5,7H,9H2 |
| InChIKey | VMBGXEXCTCTSOP-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |