C8H8N4 — CID 150956746
6H-pyrimido[5,4-c]azepin-2-amine (PubChem CID 150956746) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 6H-pyrimido[5,4-c]azepin-2-amine.
| Compound Name | 6H-pyrimido[5,4-c]azepin-2-amine |
|---|---|
| PubChem CID | 150956746 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6H-pyrimido[5,4-c]azepin-2-amine |
| SMILES | Nc1ncc2c(n1)=CC=CNC=2 |
| InChI | InChI=1S/C8H8N4/c9-8-11-5-6-4-10-3-1-2-7(6)12-8/h1-5,10H,(H2,9,12) |
| InChIKey | XMQIWAQYEYMGFE-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |