C8H5N3 — CID 138606329
2,5,11-triazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene (PubChem CID 138606329) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 2,5,11-triazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene.
| Compound Name | 2,5,11-triazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 138606329 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2,5,11-triazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene |
| SMILES | C1=CN=c2ncccc2=CN=1 |
| InChI | InChI=1S/C8H5N3/c1-2-7-6-9-4-5-11-8(7)10-3-1/h1-3,5-6H |
| InChIKey | VLFAFWBBWXINFN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |