C12H12N2 — CID 90722831
N'-ethenyl-N-methylidenecyclooctatetraenecarboximidamide (PubChem CID 90722831) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N'-ethenyl-N-methylidenecyclooctatetraenecarboximidamide.
| Compound Name | N'-ethenyl-N-methylidenecyclooctatetraenecarboximidamide |
|---|---|
| PubChem CID | 90722831 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N'-ethenyl-N-methylidenecyclooctatetraenecarboximidamide |
| SMILES | C=C/N=C(\N=C)C1=CC=CC=CC=C1 |
| InChI | InChI=1S/C12H12N2/c1-3-14-12(13-2)11-9-7-5-4-6-8-10-11/h3-10H,1-2H2/b5-4?,6-4?,7-5?,8-6?,9-7?,10-8?,11-9?,11-10?,14-12- |
| InChIKey | MWLSCAIBVMNECG-XNNOLFOBSA-N |
| XLogP | 2.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|