C11H12N2 — CID 123510649
N'-methyl-N-methylidenecyclooctatetraenecarboximidamide (PubChem CID 123510649) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-methyl-N-methylidenecyclooctatetraenecarboximidamide.
| Compound Name | N'-methyl-N-methylidenecyclooctatetraenecarboximidamide |
|---|---|
| PubChem CID | 123510649 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N'-methyl-N-methylidenecyclooctatetraenecarboximidamide |
| SMILES | C=N/C(=N\C)C1=CC=CC=CC=C1 |
| InChI | InChI=1S/C11H12N2/c1-12-11(13-2)10-8-6-4-3-5-7-9-10/h3-9H,1H2,2H3/b4-3?,5-3?,6-4?,7-5?,8-6?,9-7?,10-8?,10-9?,13-11- |
| InChIKey | MZERWZDRYWBCKT-CAJRRVMMSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|