C12H17N3 — CID 123348002
(2E,3Z)-N-(1-aminoethylidene)-2-ethylidene-N'-methylhepta-3,5,6-trienimidamide (PubChem CID 123348002) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (2E,3Z)-N-(1-aminoethylidene)-2-ethylidene-N'-methylhepta-3,5,6-trienimidamide.
| Compound Name | (2E,3Z)-N-(1-aminoethylidene)-2-ethylidene-N'-methylhepta-3,5,6-trienimidamide |
|---|---|
| PubChem CID | 123348002 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (2E,3Z)-N-(1-aminoethylidene)-2-ethylidene-N'-methylhepta-3,5,6-trienimidamide |
| SMILES | C=C=C/C=C\C(=C/C)C(=NC)/N=C(\C)N |
| InChI | InChI=1S/C12H17N3/c1-5-7-8-9-11(6-2)12(14-4)15-10(3)13/h6-9H,1H2,2-4H3,(H2,13,14,15)/b9-8-,11-6+ |
| InChIKey | UTVWDYLPLKJQIY-XSONURMYSA-N |
| XLogP | 2.24 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|