C9H13FN2 — CID 144000610
(2E,3E)-2-ethylidene-4-fluoro-N'-methylhexa-3,5-dienimidamide (PubChem CID 144000610) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-fluoro-N'-methylhexa-3,5-dienimidamide.
| Compound Name | (2E,3E)-2-ethylidene-4-fluoro-N'-methylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 144000610 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-fluoro-N'-methylhexa-3,5-dienimidamide |
| SMILES | C/C=C(\C=C(/C=C)\F)/C(=NC)N |
| InChI | InChI=1S/C9H13FN2/c1-4-7(9(11)12-3)6-8(10)5-2/h4-6H,2H2,1,3H3,(H2,11,12)/b7-4+,8-6+ |
| InChIKey | VDXWTHUUGMHLLS-IJYBVRAASA-N |
| XLogP | 1.50 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 249 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|