C11H17FN2 — CID 170194613
(Z)-N'-ethenyl-2-[(E)-1-fluoroprop-1-enyl]-3-methylpent-2-enimidamide (PubChem CID 170194613) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is (Z)-N'-ethenyl-2-[(E)-1-fluoroprop-1-enyl]-3-methylpent-2-enimidamide.
| Compound Name | (Z)-N'-ethenyl-2-[(E)-1-fluoroprop-1-enyl]-3-methylpent-2-enimidamide |
|---|---|
| PubChem CID | 170194613 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (Z)-N'-ethenyl-2-[(E)-1-fluoroprop-1-enyl]-3-methylpent-2-enimidamide |
| SMILES | C=C/N=C(N)/C(=C(\C)CC)C(/F)=C\C |
| InChI | InChI=1S/C11H17FN2/c1-5-8(4)10(9(12)6-2)11(13)14-7-3/h6-7H,3,5H2,1-2,4H3,(H2,13,14)/b9-6+,10-8+ |
| InChIKey | AOTIKEYTIPHAGP-OAMUUVBCSA-N |
| XLogP | 3.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|