C13H17FN2 — CID 167098863
(4E)-5-fluoro-4-[(Z)-2-methylhex-4-en-3-ylidene]-3-methylidenepyridin-2-amine (PubChem CID 167098863) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is (4E)-5-fluoro-4-[(Z)-2-methylhex-4-en-3-ylidene]-3-methylidenepyridin-2-amine.
| Compound Name | (4E)-5-fluoro-4-[(Z)-2-methylhex-4-en-3-ylidene]-3-methylidenepyridin-2-amine |
|---|---|
| PubChem CID | 167098863 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (4E)-5-fluoro-4-[(Z)-2-methylhex-4-en-3-ylidene]-3-methylidenepyridin-2-amine |
| SMILES | C=c1c(N)ncc(F)/c1=C(/C=C\C)C(C)C |
| InChI | InChI=1S/C13H17FN2/c1-5-6-10(8(2)3)12-9(4)13(15)16-7-11(12)14/h5-8H,4H2,1-3H3,(H2,15,16)/b6-5-,12-10- |
| InChIKey | HKYQGJPVIHYCQI-BYZVSTBBSA-N |
| XLogP | 1.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |