C9H13FN2 — CID 126755990
3-ethyl-6-fluoro-5-methyl-3H-azepin-2-amine (PubChem CID 126755990) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-5-methyl-3H-azepin-2-amine.
| Compound Name | 3-ethyl-6-fluoro-5-methyl-3H-azepin-2-amine |
|---|---|
| PubChem CID | 126755990 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 3-ethyl-6-fluoro-5-methyl-3H-azepin-2-amine |
| SMILES | CCC1C=C(C)C(F)=CN=C1N |
| InChI | InChI=1S/C9H13FN2/c1-3-7-4-6(2)8(10)5-12-9(7)11/h4-5,7H,3H2,1-2H3,(H2,11,12) |
| InChIKey | MYPWCNREVOVMAV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |