C10H16N2 — CID 90084188
4,6-diethyl-3H-azepin-2-amine (PubChem CID 90084188) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4,6-diethyl-3H-azepin-2-amine.
| Compound Name | 4,6-diethyl-3H-azepin-2-amine |
|---|---|
| PubChem CID | 90084188 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4,6-diethyl-3H-azepin-2-amine |
| SMILES | CCC1=CN=C(N)CC(CC)=C1 |
| InChI | InChI=1S/C10H16N2/c1-3-8-5-9(4-2)7-12-10(11)6-8/h5,7H,3-4,6H2,1-2H3,(H2,11,12) |
| InChIKey | HGGXWJUNVSIPJH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |