C9H12F3N3 — CID 162572083
3-ethyl-6-(trifluoromethyl)-3H-azepine-2,5-diamine (PubChem CID 162572083) has the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. Its IUPAC name is 3-ethyl-6-(trifluoromethyl)-3H-azepine-2,5-diamine.
| Compound Name | 3-ethyl-6-(trifluoromethyl)-3H-azepine-2,5-diamine |
|---|---|
| PubChem CID | 162572083 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-ethyl-6-(trifluoromethyl)-3H-azepine-2,5-diamine |
| SMILES | CCC1C=C(N)C(C(F)(F)F)=CN=C1N |
| InChI | InChI=1S/C9H12F3N3/c1-2-5-3-7(13)6(9(10,11)12)4-15-8(5)14/h3-5H,2,13H2,1H3,(H2,14,15) |
| InChIKey | TUEWILQTOOSGPT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |