C10H11FN2 — CID 142470342
N'-ethenyl-5-fluoro-2-methyl-3-methylidenecyclopenta-1,4-diene-1-carboximidamide (PubChem CID 142470342) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is N'-ethenyl-5-fluoro-2-methyl-3-methylidenecyclopenta-1,4-diene-1-carboximidamide.
| Compound Name | N'-ethenyl-5-fluoro-2-methyl-3-methylidenecyclopenta-1,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 142470342 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N'-ethenyl-5-fluoro-2-methyl-3-methylidenecyclopenta-1,4-diene-1-carboximidamide |
| SMILES | C=C/N=C(\N)C1=C(C)C(=C)C=C1F |
| InChI | InChI=1S/C10H11FN2/c1-4-13-10(12)9-7(3)6(2)5-8(9)11/h4-5H,1-2H2,3H3,(H2,12,13) |
| InChIKey | BZBMIHOGKGMRNE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|