C13H19FN2 — CID 164867167
N'-[(3E)-5-fluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]-2-methylprop-2-enimidamide (PubChem CID 164867167) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is N'-[(3E)-5-fluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]-2-methylprop-2-enimidamide.
| Compound Name | N'-[(3E)-5-fluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]-2-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 164867167 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N'-[(3E)-5-fluoro-2,6-dimethylhepta-1,3,5-trien-3-yl]-2-methylprop-2-enimidamide |
| SMILES | C=C(C)/C(N)=N/C(=C/C(F)=C(C)C)C(=C)C |
| InChI | InChI=1S/C13H19FN2/c1-8(2)11(14)7-12(9(3)4)16-13(15)10(5)6/h7H,3,5H2,1-2,4,6H3,(H2,15,16)/b12-7+ |
| InChIKey | SGKAGNRGTIGJHH-KPKJPENVSA-N |
| XLogP | 3.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|