C13H15N3 — CID 130294574
N-[(Z)-2-[(5Z,7Z)-6-methyl-9-methylidene-4H-1,3-diazecin-5-yl]ethenyl]methanimine (PubChem CID 130294574) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[(Z)-2-[(5Z,7Z)-6-methyl-9-methylidene-4H-1,3-diazecin-5-yl]ethenyl]methanimine.
| Compound Name | N-[(Z)-2-[(5Z,7Z)-6-methyl-9-methylidene-4H-1,3-diazecin-5-yl]ethenyl]methanimine |
|---|---|
| PubChem CID | 130294574 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(Z)-2-[(5Z,7Z)-6-methyl-9-methylidene-4H-1,3-diazecin-5-yl]ethenyl]methanimine |
| SMILES | C=N/C=C\C1=C(C)\C=C/C(=C)/C=N\C=N/C1 |
| InChI | InChI=1S/C13H15N3/c1-11-4-5-12(2)13(6-7-14-3)9-16-10-15-8-11/h4-8,10H,1,3,9H2,2H3/b5-4-,7-6-,13-12-,15-8-,16-10- |
| InChIKey | IHSPXZSPSCLXAM-KDGVKJBUSA-N |
| XLogP | 2.74 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|