C8H5N3O — CID 91247423
pyrido[2,3-e][1,4]diazepin-2-one (PubChem CID 91247423) has the molecular formula C8H5N3O and a molecular weight of 159.15 g/mol. Its IUPAC name is pyrido[2,3-e][1,4]diazepin-2-one.
| Compound Name | pyrido[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 91247423 |
| Molecular Formula | C8H5N3O |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | pyrido[2,3-e][1,4]diazepin-2-one |
| SMILES | O=c1cncc2cccnc2n1 |
| InChI | InChI=1S/C8H5N3O/c12-7-5-9-4-6-2-1-3-10-8(6)11-7/h1-5H |
| InChIKey | ILQBGRDKBCEGIA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |