About pyrrolo[2,3-b]pyridin-2-ylidenemethanone
pyrrolo[2,3-b]pyridin-2-ylidenemethanone (PubChem CID 91127600) has the molecular formula C8H4N2O
and a molecular weight of 144.13 g/mol. Its IUPAC name is pyrrolo[2,3-b]pyridin-2-ylidenemethanone.
Molecular Properties
| Compound Name | pyrrolo[2,3-b]pyridin-2-ylidenemethanone |
| PubChem CID | 91127600 |
| Molecular Formula | C8H4N2O |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | pyrrolo[2,3-b]pyridin-2-ylidenemethanone |
| SMILES | O=C=C1C=c2cccnc2=N1 |
| InChI | InChI=1S/C8H4N2O/c11-5-7-4-6-2-1-3-9-8(6)10-7/h1-4H |
| InChIKey | SQFSQGVDHIFVPH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[2,3-b]pyridin-2-ylidenemethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-b]pyridin-2-ylidenemethanone?
The IUPAC name of pyrrolo[2,3-b]pyridin-2-ylidenemethanone (CID 91127600) is pyrrolo[2,3-b]pyridin-2-ylidenemethanone.
What is the SMILES notation for pyrrolo[2,3-b]pyridin-2-ylidenemethanone?
The canonical SMILES for pyrrolo[2,3-b]pyridin-2-ylidenemethanone is O=C=C1C=c2cccnc2=N1.
What is the InChIKey of pyrrolo[2,3-b]pyridin-2-ylidenemethanone?
The InChIKey is SQFSQGVDHIFVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O/c11-5-7-4-6-2-1-3-9-8(6)10-7/h1-4H.
What are the key properties of pyrrolo[2,3-b]pyridin-2-ylidenemethanone?
pyrrolo[2,3-b]pyridin-2-ylidenemethanone has a molecular weight of 144.13 g/mol, XLogP of -0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-b]pyridin-2-ylidenemethanone is sourced from PubChem (CID 91127600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).