C22H39N3 — CID 142354954
(3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine;ethane (PubChem CID 142354954) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine;ethane.
| Compound Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine;ethane |
|---|---|
| PubChem CID | 142354954 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine;ethane |
| SMILES | CC.[H]/N=C1C(=C/C)\C(C2CCN(C(C)C)CC2)=CN\1C1CCCCC1 |
| InChI | InChI=1S/C20H33N3.C2H6/c1-4-18-19(16-10-12-22(13-11-16)15(2)3)14-23(20(18)21)17-8-6-5-7-9-17;1-2/h4,14-17,21H,5-13H2,1-3H3;1-2H3/b18-4-,21-20+; |
| InChIKey | JEYDJUPNOMAYNU-BKSGDAQPSA-N |
| XLogP | 5.59 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|