C24H38N4 — CID 142354944
(3Z)-4-[1-[1-(2,3-dihydro-1H-pyrrol-3-yl)ethenyl]piperidin-4-yl]-3-ethylidene-1-heptan-4-ylpyrrol-2-imine (PubChem CID 142354944) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is (3Z)-4-[1-[1-(2,3-dihydro-1H-pyrrol-3-yl)ethenyl]piperidin-4-yl]-3-ethylidene-1-heptan-4-ylpyrrol-2-imine.
| Compound Name | (3Z)-4-[1-[1-(2,3-dihydro-1H-pyrrol-3-yl)ethenyl]piperidin-4-yl]-3-ethylidene-1-heptan-4-ylpyrrol-2-imine |
|---|---|
| PubChem CID | 142354944 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (3Z)-4-[1-[1-(2,3-dihydro-1H-pyrrol-3-yl)ethenyl]piperidin-4-yl]-3-ethylidene-1-heptan-4-ylpyrrol-2-imine |
| SMILES | [H]/N=C1C(=C\C)/C(C2CCN(C(=C)C3C=CNC3)CC2)=CN/1C(CCC)CCC |
| InChI | InChI=1S/C24H38N4/c1-5-8-21(9-6-2)28-17-23(22(7-3)24(28)25)19-11-14-27(15-12-19)18(4)20-10-13-26-16-20/h7,10,13,17,19-21,25-26H,4-6,8-9,11-12,14-16H2,1-3H3/b22-7-,25-24- |
| InChIKey | MFPQYNJSLJGZPX-MPKCLKPLSA-N |
| XLogP | 5.04 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|