C27H42N4 — CID 145324460
(E,2E)-2-ethylidene-4-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-5-methyl-1-piperazin-1-ylhept-3-en-1-imine (PubChem CID 145324460) has the molecular formula C27H42N4 and a molecular weight of 422.66 g/mol. Its IUPAC name is (E,2E)-2-ethylidene-4-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-5-methyl-1-piperazin-1-ylhept-3-en-1-imine.
| Compound Name | (E,2E)-2-ethylidene-4-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-5-methyl-1-piperazin-1-ylhept-3-en-1-imine |
|---|---|
| PubChem CID | 145324460 |
| Molecular Formula | C27H42N4 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | (E,2E)-2-ethylidene-4-[[(2E,3Z)-3-ethylidene-2-[(Z)-hex-2-enylidene]pyrrol-1-yl]methyl]-5-methyl-1-piperazin-1-ylhept-3-en-1-imine |
| SMILES | [H]/N=C(C(=C\C)\C=C(\Cn1ccc(=C/C)/c1=C\C=C/CCC)C(C)CC)/N1CCNCC1 |
| InChI | InChI=1S/C27H42N4/c1-6-10-11-12-13-26-23(8-3)14-17-31(26)21-25(22(5)7-2)20-24(9-4)27(28)30-18-15-29-16-19-30/h8-9,11-14,17,20,22,28-29H,6-7,10,15-16,18-19,21H2,1-5H3/b12-11-,23-8-,24-9+,25-20-,26-13+,28-27+ |
| InChIKey | LJDLAPDMQIUYRM-VCRHFQFISA-N |
| XLogP | 4.23 |
| TPSA | 44.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|