C14H29N3 — CID 166128167
(E)-3,5-dimethyl-1-piperazin-1-ylhex-2-en-1-imine;ethane (PubChem CID 166128167) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is (E)-3,5-dimethyl-1-piperazin-1-ylhex-2-en-1-imine;ethane.
| Compound Name | (E)-3,5-dimethyl-1-piperazin-1-ylhex-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 166128167 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | (E)-3,5-dimethyl-1-piperazin-1-ylhex-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C(\C=C(/C)CC(C)C)N1CCNCC1 |
| InChI | InChI=1S/C12H23N3.C2H6/c1-10(2)8-11(3)9-12(13)15-6-4-14-5-7-15;1-2/h9-10,13-14H,4-8H2,1-3H3;1-2H3/b11-9+,13-12+; |
| InChIKey | HXXTXPCSRHAKBM-RTCSUJOXSA-N |
| XLogP | 2.89 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|