C9H16N2O3 — CID 58010631
(2R)-2-hydroxy-1-piperazin-1-ylpentane-1,4-dione (PubChem CID 58010631) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-piperazin-1-ylpentane-1,4-dione.
| Compound Name | (2R)-2-hydroxy-1-piperazin-1-ylpentane-1,4-dione |
|---|---|
| PubChem CID | 58010631 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2R)-2-hydroxy-1-piperazin-1-ylpentane-1,4-dione |
| SMILES | CC(=O)C[C@@H](O)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H16N2O3/c1-7(12)6-8(13)9(14)11-4-2-10-3-5-11/h8,10,13H,2-6H2,1H3/t8-/m1/s1 |
| InChIKey | GMNDAWFQUCFCRV-MRVPVSSYSA-N |
| XLogP | -1.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |