About N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen
N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen (PubChem CID 170740622) has the molecular formula C7H17N5
and a molecular weight of 171.25 g/mol. Its IUPAC name is N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen |
| PubChem CID | 170740622 |
| Molecular Formula | C7H17N5 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen |
| SMILES | [H]/N=C(\N(C)/C=N/[H])N1CCNCC1.[H][H] |
| InChI | InChI=1S/C7H15N5.H2/c1-11(6-8)7(9)12-4-2-10-3-5-12;/h6,8-10H,2-5H2,1H3;1H/b8-6+,9-7+; |
| InChIKey | DWPUIIJOWILOTN-SLGVWIAZSA-N |
| XLogP | -0.39 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen?
The IUPAC name of N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen (CID 170740622) is N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen.
What is the SMILES notation for N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen?
The canonical SMILES for N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen is [H]/N=C(\N(C)/C=N/[H])N1CCNCC1.[H][H].
What is the InChIKey of N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen?
The InChIKey is DWPUIIJOWILOTN-SLGVWIAZSA-N. The full InChI is InChI=1S/C7H15N5.H2/c1-11(6-8)7(9)12-4-2-10-3-5-12;/h6,8-10H,2-5H2,1H3;1H/b8-6+,9-7+;.
What are the key properties of N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen?
N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen has a molecular weight of 171.25 g/mol, XLogP of -0.39, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methanimidoyl-N-methylpiperazine-1-carboximidamide;molecular hydrogen is sourced from PubChem (CID 170740622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).