C10H23ClN4O2 — CID 174785913
tert-butyl formate;piperazine-1-carboximidamide;hydrochloride (PubChem CID 174785913) has the molecular formula C10H23ClN4O2 and a molecular weight of 266.77 g/mol. Its IUPAC name is tert-butyl formate;piperazine-1-carboximidamide;hydrochloride.
| Compound Name | tert-butyl formate;piperazine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 174785913 |
| Molecular Formula | C10H23ClN4O2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | tert-butyl formate;piperazine-1-carboximidamide;hydrochloride |
| SMILES | CC(C)(C)OC=O.Cl.[H]/N=C(\N)N1CCNCC1 |
| InChI | InChI=1S/C5H12N4.C5H10O2.ClH/c6-5(7)9-3-1-8-2-4-9;1-5(2,3)7-4-6;/h8H,1-4H2,(H3,6,7);4H,1-3H3;1H |
| InChIKey | VWURIXUJEVJXQK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|