C16H24FN3O3 — CID 158797916
(4-amino-3-fluorophenyl)-piperazin-1-ylmethanone;tert-butyl formate (PubChem CID 158797916) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is (4-amino-3-fluorophenyl)-piperazin-1-ylmethanone;tert-butyl formate.
| Compound Name | (4-amino-3-fluorophenyl)-piperazin-1-ylmethanone;tert-butyl formate |
|---|---|
| PubChem CID | 158797916 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4-amino-3-fluorophenyl)-piperazin-1-ylmethanone;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.Nc1ccc(C(=O)N2CCNCC2)cc1F |
| InChI | InChI=1S/C11H14FN3O.C5H10O2/c12-9-7-8(1-2-10(9)13)11(16)15-5-3-14-4-6-15;1-5(2,3)7-4-6/h1-2,7,14H,3-6,13H2;4H,1-3H3 |
| InChIKey | ITCCIWYUZGDPEN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|