C11H13F2N3O — CID 82511462
(5-amino-2,4-difluorophenyl)-piperazin-1-ylmethanone (PubChem CID 82511462) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is (5-amino-2,4-difluorophenyl)-piperazin-1-ylmethanone.
| Compound Name | (5-amino-2,4-difluorophenyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 82511462 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (5-amino-2,4-difluorophenyl)-piperazin-1-ylmethanone |
| SMILES | Nc1cc(C(=O)N2CCNCC2)c(F)cc1F |
| InChI | InChI=1S/C11H13F2N3O/c12-8-6-9(13)10(14)5-7(8)11(17)16-3-1-15-2-4-16/h5-6,15H,1-4,14H2 |
| InChIKey | JCXCBRDPEOEIML-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|