C21H34N2 — CID 143629797
1-[(Z)-1-cyclopropylidene-5,6-bis(ethenyl)-2-methylnon-5-enyl]piperazine (PubChem CID 143629797) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-[(Z)-1-cyclopropylidene-5,6-bis(ethenyl)-2-methylnon-5-enyl]piperazine.
| Compound Name | 1-[(Z)-1-cyclopropylidene-5,6-bis(ethenyl)-2-methylnon-5-enyl]piperazine |
|---|---|
| PubChem CID | 143629797 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-[(Z)-1-cyclopropylidene-5,6-bis(ethenyl)-2-methylnon-5-enyl]piperazine |
| SMILES | C=C/C(CCC)=C(\C=C)CCC(C)C(=C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C21H34N2/c1-5-8-18(6-2)19(7-3)10-9-17(4)21(20-11-12-20)23-15-13-22-14-16-23/h6-7,17,22H,2-3,5,8-16H2,1,4H3/b19-18- |
| InChIKey | FJYCSSCTRFZXCV-HNENSFHCSA-N |
| XLogP | 4.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|