C11H19N3O — CID 70546144
N,N-bis(prop-2-enyl)piperazine-1-carboxamide (PubChem CID 70546144) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)piperazine-1-carboxamide.
| Compound Name | N,N-bis(prop-2-enyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70546144 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N,N-bis(prop-2-enyl)piperazine-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H19N3O/c1-3-7-13(8-4-2)11(15)14-9-5-12-6-10-14/h3-4,12H,1-2,5-10H2 |
| InChIKey | GRIBCIGWMQBCPP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|