C12H18N2O2 — CID 108516735
2-oxo-N,N-bis(prop-2-enyl)-2-pyrrolidin-1-ylacetamide (PubChem CID 108516735) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-oxo-N,N-bis(prop-2-enyl)-2-pyrrolidin-1-ylacetamide.
| Compound Name | 2-oxo-N,N-bis(prop-2-enyl)-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 108516735 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-oxo-N,N-bis(prop-2-enyl)-2-pyrrolidin-1-ylacetamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-7-13(8-4-2)11(15)12(16)14-9-5-6-10-14/h3-4H,1-2,5-10H2 |
| InChIKey | RHQUXOFHFMZFCQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|