C11H19N3O3 — CID 83019737
2-[piperidin-1-ylcarbamoyl(prop-2-enyl)amino]acetic acid (PubChem CID 83019737) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[piperidin-1-ylcarbamoyl(prop-2-enyl)amino]acetic acid.
| Compound Name | 2-[piperidin-1-ylcarbamoyl(prop-2-enyl)amino]acetic acid |
|---|---|
| PubChem CID | 83019737 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[piperidin-1-ylcarbamoyl(prop-2-enyl)amino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C11H19N3O3/c1-2-6-13(9-10(15)16)11(17)12-14-7-4-3-5-8-14/h2H,1,3-9H2,(H,12,17)(H,15,16) |
| InChIKey | WFXDWWGYSKKFPM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|