C10H15NO2 — CID 150340291
4-methyl-1-pyrrolidin-1-ylpent-3-ene-1,2-dione (PubChem CID 150340291) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-methyl-1-pyrrolidin-1-ylpent-3-ene-1,2-dione.
| Compound Name | 4-methyl-1-pyrrolidin-1-ylpent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 150340291 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-methyl-1-pyrrolidin-1-ylpent-3-ene-1,2-dione |
| SMILES | CC(C)=CC(=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C10H15NO2/c1-8(2)7-9(12)10(13)11-5-3-4-6-11/h7H,3-6H2,1-2H3 |
| InChIKey | GROJTQLLYNMNGK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|