C9H13NO2 — CID 71318871
3-methyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione (PubChem CID 71318871) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione.
| Compound Name | 3-methyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 71318871 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-methyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione |
| SMILES | C=C(C)C(=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C9H13NO2/c1-7(2)8(11)9(12)10-5-3-4-6-10/h1,3-6H2,2H3 |
| InChIKey | TYAULQKUTZSPNY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|