C9H13NO3 — CID 86731962
1-pyrrolidin-1-ylpentane-1,2,4-trione (PubChem CID 86731962) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylpentane-1,2,4-trione.
| Compound Name | 1-pyrrolidin-1-ylpentane-1,2,4-trione |
|---|---|
| PubChem CID | 86731962 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 1-pyrrolidin-1-ylpentane-1,2,4-trione |
| SMILES | CC(=O)CC(=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C9H13NO3/c1-7(11)6-8(12)9(13)10-4-2-3-5-10/h2-6H2,1H3 |
| InChIKey | QICIJURRBSTILF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|