C14H24N4O4 — CID 14938690
bis(ethenyl) 1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate (PubChem CID 14938690) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is bis(ethenyl) 1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate.
| Compound Name | bis(ethenyl) 1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 14938690 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | bis(ethenyl) 1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
| SMILES | C=COC(=O)N1CCNCCN(C(=O)OC=C)CCNCC1 |
| InChI | InChI=1S/C14H24N4O4/c1-3-21-13(19)17-9-5-15-7-11-18(14(20)22-4-2)12-8-16-6-10-17/h3-4,15-16H,1-2,5-12H2 |
| InChIKey | PTUZRKZEVKQQEN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|