C18H31N3 — CID 163276634
N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2-methylcyclopentan-1-amine (PubChem CID 163276634) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2-methylcyclopentan-1-amine.
| Compound Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 163276634 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2-methylcyclopentan-1-amine |
| SMILES | [H]/N=C(\C=C(/NC1CCCC1C)C(=C)C)N1CCCCC1C |
| InChI | InChI=1S/C18H31N3/c1-13(2)17(20-16-10-7-8-14(16)3)12-18(19)21-11-6-5-9-15(21)4/h12,14-16,19-20H,1,5-11H2,2-4H3/b17-12-,19-18+ |
| InChIKey | LLSHOKPTJHHKJO-YNMQTYGTSA-N |
| XLogP | 4.08 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|