C20H35N3 — CID 163276733
N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,3,3-trimethylcyclopentan-1-amine (PubChem CID 163276733) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,3,3-trimethylcyclopentan-1-amine.
| Compound Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,3,3-trimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 163276733 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,3,3-trimethylcyclopentan-1-amine |
| SMILES | [H]/N=C(\C=C(/NC1CCC(C)(C)C1C)C(=C)C)N1CCCCC1C |
| InChI | InChI=1S/C20H35N3/c1-14(2)18(22-17-10-11-20(5,6)16(17)4)13-19(21)23-12-8-7-9-15(23)3/h13,15-17,21-22H,1,7-12H2,2-6H3/b18-13-,21-19+ |
| InChIKey | CNJIVKRXYTUIRR-RQVZBFIBSA-N |
| XLogP | 4.71 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|