C22H36N4 — CID 142354927
(3Z)-1-cyclohexyl-3-ethylidene-4-(1-piperidin-4-ylpiperidin-4-yl)pyrrol-2-imine (PubChem CID 142354927) has the molecular formula C22H36N4 and a molecular weight of 356.56 g/mol. Its IUPAC name is (3Z)-1-cyclohexyl-3-ethylidene-4-(1-piperidin-4-ylpiperidin-4-yl)pyrrol-2-imine.
| Compound Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-piperidin-4-ylpiperidin-4-yl)pyrrol-2-imine |
|---|---|
| PubChem CID | 142354927 |
| Molecular Formula | C22H36N4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-piperidin-4-ylpiperidin-4-yl)pyrrol-2-imine |
| SMILES | [H]/N=C1C(=C/C)\C(C2CCN(C3CCNCC3)CC2)=CN\1C1CCCCC1 |
| InChI | InChI=1S/C22H36N4/c1-2-20-21(16-26(22(20)23)19-6-4-3-5-7-19)17-10-14-25(15-11-17)18-8-12-24-13-9-18/h2,16-19,23-24H,3-15H2,1H3/b20-2-,23-22+ |
| InChIKey | LUUGOBHWCZICOX-MVKXLZOESA-N |
| XLogP | 3.91 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|