C20H33N3 — CID 142354955
(3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine (PubChem CID 142354955) has the molecular formula C20H33N3 and a molecular weight of 315.50 g/mol. Its IUPAC name is (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine.
| Compound Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine |
|---|---|
| PubChem CID | 142354955 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (3Z)-1-cyclohexyl-3-ethylidene-4-(1-propan-2-ylpiperidin-4-yl)pyrrol-2-imine |
| SMILES | [H]/N=C1C(=C/C)\C(C2CCN(C(C)C)CC2)=CN\1C1CCCCC1 |
| InChI | InChI=1S/C20H33N3/c1-4-18-19(16-10-12-22(13-11-16)15(2)3)14-23(20(18)21)17-8-6-5-7-9-17/h4,14-17,21H,5-13H2,1-3H3/b18-4-,21-20+ |
| InChIKey | KTLZAQFDKVZXEU-PTTIKUEPSA-N |
| XLogP | 4.56 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|