C13H25LiO2Si — CID 10422141
lithium tert-butyl-[[(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy]-dimethylsilane (PubChem CID 10422141) has the molecular formula C13H25LiO2Si and a molecular weight of 248.37 g/mol. Its IUPAC name is lithium tert-butyl-[[(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy]-dimethylsilane.
| Compound Name | lithium tert-butyl-[[(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10422141 |
| Molecular Formula | C13H25LiO2Si |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | lithium tert-butyl-[[(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy]-dimethylsilane |
| SMILES | CC[C@H]1O[C-]=C[C@@H]1CO[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C13H25O2Si.Li/c1-7-12-11(8-9-14-12)10-15-16(5,6)13(2,3)4;/h8,11-12H,7,10H2,1-6H3;/q-1;+1/t11-,12-;/m1./s1 |
| InChIKey | ILACBZULMYGPPS-MNMPKAIFSA-N |
| XLogP | 0.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|