C16H31LiO2Si — CID 10446964
lithium [(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 10446964) has the molecular formula C16H31LiO2Si and a molecular weight of 290.45 g/mol. Its IUPAC name is lithium [(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | lithium [(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10446964 |
| Molecular Formula | C16H31LiO2Si |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | lithium [(2R,3R)-2-ethyl-3,5-dihydro-2H-furan-5-id-3-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC[C@H]1O[C-]=C[C@@H]1CO[Si](C(C)C)(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C16H31O2Si.Li/c1-8-16-15(9-10-17-16)11-18-19(12(2)3,13(4)5)14(6)7;/h9,12-16H,8,11H2,1-7H3;/q-1;+1/t15-,16-;/m1./s1 |
| InChIKey | AOJYMWOZIJWKPV-QNBGGDODSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|