C17H30O2 — CID 10423056
trans-(1R,2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 10423056) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is trans-(1R,2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | trans-(1R,2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10423056 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | trans-(1R,2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(CO)CCC[C@H]1O |
| InChI | InChI=1S/C17H30O2/c1-14(2)7-4-8-15(3)9-5-11-17(13-18)12-6-10-16(17)19/h7,9,16,18-19H,4-6,8,10-13H2,1-3H3/b15-9+/t16-,17-/m1/s1 |
| InChIKey | OIIVCVMROGJEAG-DKXBRRKKSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|