C10H16O — CID 11355589
(1S,7aS)-7a-methyl-1,2,3,5,6,7-hexahydroinden-1-ol (PubChem CID 11355589) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S,7aS)-7a-methyl-1,2,3,5,6,7-hexahydroinden-1-ol.
| Compound Name | (1S,7aS)-7a-methyl-1,2,3,5,6,7-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 11355589 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S,7aS)-7a-methyl-1,2,3,5,6,7-hexahydroinden-1-ol |
| SMILES | C[C@]12CCCC=C1CC[C@@H]2O |
| InChI | InChI=1S/C10H16O/c1-10-7-3-2-4-8(10)5-6-9(10)11/h4,9,11H,2-3,5-7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | FBFDSPVWVAOCKU-UWVGGRQHSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|