C17H24O5 — CID 10425388
methyl (1R,2R,3S,10S)-3-ethenyl-1-methoxyspiro[5,9-dioxatricyclo[4.3.1.03,10]decane-4,1'-cyclopentane]-2-carboxylate (PubChem CID 10425388) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (1R,2R,3S,10S)-3-ethenyl-1-methoxyspiro[5,9-dioxatricyclo[4.3.1.03,10]decane-4,1'-cyclopentane]-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,10S)-3-ethenyl-1-methoxyspiro[5,9-dioxatricyclo[4.3.1.03,10]decane-4,1'-cyclopentane]-2-carboxylate |
|---|---|
| PubChem CID | 10425388 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (1R,2R,3S,10S)-3-ethenyl-1-methoxyspiro[5,9-dioxatricyclo[4.3.1.03,10]decane-4,1'-cyclopentane]-2-carboxylate |
| SMILES | C=C[C@]12[C@@H](C(=O)OC)[C@]3(OC)OCCC(OC14CCCC4)[C@@H]32 |
| InChI | InChI=1S/C17H24O5/c1-4-16-12-11(22-15(16)8-5-6-9-15)7-10-21-17(12,20-3)13(16)14(18)19-2/h4,11-13H,1,5-10H2,2-3H3/t11?,12-,13-,16+,17-/m1/s1 |
| InChIKey | MYMHMYSQWHFPRD-LKIRTGRHSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|